If you're seeing this message, it means we're having trouble loading external resources on our website.

Bağlandığınız bilgisayar bir web filtresi kullanıyorsa, *.kastatic.org ve *.kasandbox.org adreslerinin engellerini kaldırmayı unutmayın.

Ana içerik

pH, pOH ve pH ölçeği

pH, pOH ve pH ölçeğinin tanımını, güçlü bir asit veya baz çözeltisinin pH'ını hesaplamayı ve asidin kuvveti ile bir çözeltinin pH'ı arasındaki ilişkinin ne olduğunu öğrenelim.

Önemli noktalar

  • Aşağıdaki denklemleri kullanarak open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket ve start text, p, H, end text arasında geçiş yapabiliriz:
pH=log[H+][H+]=10pH\begin{aligned}\text{pH}&=-\log[\text{H}^+]\\ \\ [\text H^+]&=10^{-\text{pH}}\end{aligned}
  • Aşağıdaki denklemleri kullanarak open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket ve start text, p, O, H, end text arasında geçiş yapabiliriz:
pOH=log[OH][OH]=10pOH\begin{aligned}\text{pOH}&=-\log[\text{OH}^-]\\ \\ [\text {OH}^-]&=10^{-\text{pOH}}\end{aligned}
  • 25, degrees, start text, C, end text'deki herhangi bir sulu çözelti için:
start text, p, H, end text, plus, start text, p, O, H, end text, equals, 14.
  • open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket derişiminde 10 faktörlük her artış için, start text, p, H, end text 1 birim azalacaktır, aynı durum, bunun tam tersi için de geçerlidir.
  • open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket ve start text, p, H, end text'ı, asidin hem kuvveti hem derişimi belirler.

Giriş

Sulu bir çözeltide, asitler, start text, H, end text, start superscript, plus, end superscript, left parenthesis, a, q, right parenthesis derişimini yükselten; bazlar ise start text, O, H, end text, start superscript, minus, end superscript, left parenthesis, s, u, d, a, right parenthesis derişimini yükselten herhangi türler olarak tanımlanmıştır. Bu iyonların çözeltideki tipik derişimleri son derece küçük olabileceği gibi, ayrıca geniş bir aralıkta da olabilir.
Pembemsi mor ortancaların yanında mor mavi ortancalar.
Ortancaların rengi büyük ölçüde toprağın pH'ına bağlıdır. Mavi çiçekli ortancalar, pH'ı 6'dan az olan asidik topraklarda; pembe çiçekli ortancalar ise pH'ı 6'nın üstünde olan topraklarda yetişir. Fotoğraf, Wikimedia Commons, CC BY 2,0
Örneğin, 25, degrees, start text, C, end text'deki bir saf su numunesi, 1, comma, 0, times, 10, start superscript, minus, 7, end superscript, start text, space, M, end text start text, H, end text, start superscript, plus, end superscript ve start text, O, H, end text, start superscript, minus, end superscript içerir. Buna kıyasla, mide asidindeki start text, H, end text, start superscript, plus, end superscript derişimi yaklaşık oalrak 1, comma, 0, times, 10, start superscript, minus, 1, end superscript, start text, M, end text'ye kadar olabilir. Bu, mide asidinin open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket'ının, saf suyunkinden yaklaşık 6 kat büyük olduğu anlamını taşır!
Bilim insanları, böyle zor sayılarla uğraşmamak için bu derişimleri start text, p, H, end text veya start text, p, O, H, end text değerlerine çevirir. Haydi hemen start text, p, H, end text ve start text, p, O, H, end text'ın tanımlarını inceleyelim.

start text, p, H, end text ve start text, p, O, H, end text'ın tanımı

open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket ile start text, p, H, end text arasındaki ilişki

Bir sulu çözeltinin start text, p, H, end text'ı, open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket değerinden yola çıkılarak, aşağıdaki denklemle hesaplanır:
start text, p, H, end text, equals, minus, log, open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket, start text, left parenthesis, D, e, n, k, l, e, m, space, 1, a, right parenthesis, end text
Küçük start text, p, end text harfi, `, `, minus, start text, l, o, g, end text, start subscript, 10, end subscript, "u belirtir. İnsanlar genelde daha basit olması adına, 10 tabanını yazmazlar.
Örneğin, eğer open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket, equals, 1, times, 10, start superscript, minus, 5, end superscript, start text, space, M, end text olan bir çözeltimiz varsa, start text, p, H, end textDenklem 1a'yı kullanarak hesaplayabiliriz:
start text, p, H, end text, equals, minus, log, left parenthesis, 1, times, 10, start superscript, minus, 5, end superscript, right parenthesis, equals, 5, comma, 0
start text, p, H, end text'ı verilen bir çözeltinin, open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket değerini de bulabiliriz:
open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket, equals, 10, start superscript, minus, start text, p, H, end text, end superscript, start text, left parenthesis, D, e, n, k, l, e, m, space, 1, b, right parenthesis, end text

open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket ve start text, p, O, H, end text arasındaki ilişki

Sulu bir çözelti için start text, p, O, H, end text, open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket ile aynı şekilde tanımlanır:
start text, p, O, H, end text, equals, minus, log, open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket, space, start text, left parenthesis, D, e, n, k, l, e, m, space, 2, a, right parenthesis, end text
Örneğin, eğer open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket, equals, 1, times, 10, start superscript, minus, 12, end superscript, start text, space, M, end text olan bir çözeltimiz varsa, start text, p, O, H, end textDenklem 2a'yı kullanarak hesaplayabiliriz:
start text, p, O, H, end text, equals, minus, log, left parenthesis, 1, times, 10, start superscript, minus, 12, end superscript, right parenthesis, equals, 12, comma, 0
start text, p, O, H, end text'ı verilen bir çözeltinin, open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket değerini de bulabiliriz:
10, start superscript, minus, start text, p, O, H, end text, end superscript, equals, open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket, start text, left parenthesis, D, e, n, k, l, e, m, space, 2, b, right parenthesis, end text

start text, p, H, end text ve start text, p, O, H, end text arasındaki ilişki

start text, H, end text, start superscript, plus, end superscript and start text, O, H, end text, start superscript, minus, end superscript'nin sudaki denge derişimlerine göre, aşağıdaki ilişki 25, degrees, start text, C, end text'deki herhangi bir sulu çözelti için doğrudur:
start text, p, H, end text, plus, start text, p, O, H, end text, equals, 14, space, space, start text, left parenthesis, D, e, n, k, l, e, m, space, 3, right parenthesis, end text
Bu ilişki, start text, p, H, end text ve start text, p, O, H, end text'ı birbirine çevirmek için kullanılabilir. Denklem 1a/b ve Denklem 2a/b ile birlikte, daima start text, p, O, H, end text ve/veya start text, p, H, end text ile open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket ve open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket arasındaki ilişkiyi bulabiliriz. Bu denklemin nasıl elde edildiğini görmek isterseniz, suyun kendiliğinden iyonlaşmasına ilişkin makaleye göz atın.

Örnek 1: Kuvvetli bir bazik çözeltinin start text, p, H, end text'ını hesaplayalım

25, degrees, start text, C, end text'de 1, comma, 0, start text, space, L, end text sulu çözelti yapmak için eğer 1, comma, 0, start text, space, m, m, o, l, end text start text, N, a, O, H, end text kullanırsak, bu çözeltinin start text, p, H, end text'ı ne olur?
start text, N, a, O, H, end text çözeltimizin start text, p, H, end text'ını open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket, start text, p, H, end text ve start text, p, O, H, end text arasındaki ilişkiyi kullanarak bulabiliriz. Şimdi, hesaplamanın üzerinden adım adım geçelim.

1. Adım: start text, N, a, O, H, end text'nin molar derişimini hesaplayın

Molar derişim, litre başına kaç mol çözünen bulunduğunu verir:
start text, M, o, l, a, r, space, d, e, r, i, ş, i, m, end text, equals, start fraction, start text, ç, o, with, \", on top, z, u, with, \", on top, n, e, n, space, m, a, d, d, e, n, i, n, space, m, o, l, space, s, a, y, ı, s, ı, end text, divided by, start text, ç, o, with, \", on top, z, e, l, t, i, n, i, n, space, l, i, t, r, e, space, c, i, n, s, i, n, d, e, n, space, h, a, c, m, i, end text, end fraction
start text, N, a, O, H, end text'nin molar derişimini hesaplamak için, bildiğimiz, start text, N, a, O, H, end text'ın mol sayısı ve çözelti hacmi değerlerini kullanabiliriz:
[NaOH]=1,0 mmol NaOH1,0 L=1,0×103 mol NaOH1,0 L=1,0×103 M NaOH\begin{aligned}\text{[NaOH]}&=\dfrac{1,0\text{ mmol NaOH}}{1,0\text{ L}}\\ \\ &=\dfrac{1,0\times10^{-3}\text{ mol NaOH}}{1,0\text{ L}}\\ \\ &=1,0\times10^{-3}\text{ M NaOH}\end{aligned}
Çözeltideki start text, N, a, O, H, end text derişimi 1, comma, 0, times, 10, start superscript, minus, 3, end superscript, start text, space, M, end text'dir.

2. Adım: start text, N, a, O, H, end text2nin ayrışmasına bağlı olarak open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket'yi hesaplayın

start text, N, a, O, H, end text kuvvetli bir baz olduğundan, sulu çözeltide bileşen iyonlarına tamamen ayrışır:
start text, N, a, O, H, end text, left parenthesis, a, q, right parenthesis, right arrow, start text, N, a, end text, start superscript, plus, end superscript, left parenthesis, a, q, right parenthesis, plus, start text, O, H, end text, start superscript, minus, end superscript, left parenthesis, a, q, right parenthesis
Dengelenmiş bu denklem bize her start text, N, a, O, H, end text molünun sulu çözeltide bir mol start text, O, H, end text, start superscript, minus, end superscript ürettiğini söyler. Dolayısıyla, open bracket, start text, N, a, O, H, end text, close bracket ve open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket arasında aşağıdaki ilişkiyi elde ederiz:
open bracket, start text, N, a, O, H, end text, close bracket, equals, open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket, equals, 1, comma, 0, times, 10, start superscript, minus, 3, end superscript, start text, space, M, end text

3. Adım: Denklem 2a'yı kullanarak open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket'den start text, p, O, H, end text'ı hesaplayın

start text, O, H, end text, start superscript, minus, end superscript derişimi bildiğimize göre, Denklem 2a'yı kullanarak start text, p, O, H, end text'ı hesaplayabiliriz:
pOH=log[OH]=log(1,0×103)=3,00\begin{aligned}\text{pOH}&=-\log[\text{OH}^-]\\ \\ &=-\log(1,0\times10^{-3})\\ \\ &=3,00\end{aligned}
Çözeltimizin start text, p, O, H, end text3, comma, 00'tür.

4. Adım: Denklem 3'ü kullanarak start text, p, O, H, end text'dan start text, p, H, end text'ı hesaplayın

Denklem 3'ü kullanarak, start text, p, O, H, end text'dan start text, p, H, end text'ı hesaplayabiliriz. Denklemi, bilinmeyeni yani start text, p, H, end text'ı bulmak için yeniden düzenlersek:
start text, p, H, end text, equals, 14, minus, start text, p, O, H, end text
start text, p, H, end text'ı bulmak için, Adım 3'te bulduğumuz start text, p, O, H, end text değerini denkleme yerleştirebiliriz:
start text, p, H, end text, equals, 14, minus, 3, comma, 00, equals, 11, comma, 00
Buna göre, start text, N, a, O, H, end text çözeltimizin start text, p, H, end text11, comma, 00'dir.

start text, p, H, end text ölçeği: Asidik, bazik ve nötr çözeltiler

Bir çözeltinin göreli asitliğini veya bazlığını ölçmek için open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket'yı start text, p, H, end text 'a çevirmek kullanışlı bir yöntemdir. start text, p, H, end text ölçeği, farklı maddeleri, start text, p, H, end text değerlerine göre kolayca sıralamamızı sağlar.
start text, p, H, end text ölçeği, bir negatif logaritma ölçeğidir. Logaritma kısmı, start text, H, end text, start superscript, plus, end superscript derişiminde her 10 faktörlük bir değişim için start text, p, H, end text'ın 1 birim değiştiği anlamına gelir. Logaritmanın önündeki eksi işareti bize start text, p, H, end text ve open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket arasında ters bir ilişki olduğunu söyler: start text, p, H, end text yükseldiğinde, open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket düşer; ve bunun tam tersi de geçerlidir.
Aşağıdaki görselde, evde sık kullanılan bazı maddelerin start text, p, H, end text değerlerini gösteren bir start text, p, H, end text ölçeği görülmektedir. Bu start text, p, H, end text değerleri, 25, degrees, start text, C, end text'deki çözeltilere aittir. start text, p, H, end text değerinin negatif olabileceğine dikkatinizi çekmek istiyoruz.
-1'den 14'e pH ölçeği.
pH ölçeği. Asidik çözeltilerin pH değerleri 7'den küçük, bazik çözeltilerin pH değerleri ise 7'den büyüktür Görsel UCDavis ChemWiki, CC BY-NC-SA 3,0 US.
25, degrees, start text, C, end text'deki sulu çözeltiler için aklımızda tutmamız gereken bazı önemli terminolojiler:
  • Nötr bir çözelti için start text, p, H, end text, equals, 7'dir.
  • Asidik çözeltilerde start text, p, H, end text, is less than, 7'dir.
  • Bazik çözeltilerde start text, p, H, end text, is greater than, 7'dir.
start text, p, H, end text değeri ne kadar düşükse çözelti o kadar asidik ve start text, H, end text, start superscript, plus, end superscript derişimi o kadar yüksek olur. start text, p, H, end text değeri ne kadar yüksekse, çözelti o kadar bazik ve start text, H, end text, start superscript, plus, end superscript derişimi o kadar düşük olur. Bir çözeltinin asitliğini veya bazlığını start text, p, O, H, end text cinsinden de tanımlayabiliriz, ancak genelde start text, p, H, end text kullanılır. Neyse ki start text, p, H, end text ve start text, p, O, H, end text değerleri arasında geçiş yapmak pek de zor değildir.
Kavram kontrolü: Yukarıda verilen start text, p, H, end text ölçeğine göre, hangi çözelti daha asidiktirminusportakal suyu mu yoksa sirke mi?

Örnek 2: Seyreltilmiş kuvvetli asit çözeltisinin start text, p, H, end text'ını belirleyelim

start text, p, H, end text4, comma, 0 olan 100, start text, space, m, L, end text nitrik asit çözeltimiz var. Çözeltiyi toplam hacmi 1, comma, 0, start text, space, L, end text olacak şekilde suyla seyreltiyoruz.
Seyreltilmiş çözeltinin start text, p, H, end text'ı nedir?
Bu problemi çözmenin pek çok yolu bulunmaktadır. Biz iki farklı yöntemin üzerinden geçeceğiz.

1. Yöntem: Logaritma ölçeğinin özelliklerini kullanın

start text, p, H, end text ölçeğinin, bir negatif logaritmik ölçek olduğunu hatırlayın. Buna göre, eğer start text, H, end text, start superscript, plus, end superscript derişimi 10 faktörüyle azaldığında, start text, p, H, end text 1 birim artacaktır.
Başlangıçtaki hacim (100, start text, space, m, L, end text) seyreltmeden sonraki hacmin onda biri olduğundan, çözeltideki start text, H, end text, start superscript, plus, end superscript derişimi 10 faktörüyle azalmıştır. Buna göre, çözeltinin start text, p, H, end text1 birim artacaktır:
pH=ilk pH+1,0=4,0+1,0=5,0\begin{aligned}\text{pH}&=\text{ilk pH}+1,0 \\ \\ &=4,0+1,0\\ \\ &=5,0\end{aligned}
Buna göre, seyreltilmiş çözeltinin start text, p, H, end text5, comma, 0'dır.

2. Yöntem: start text, p, H, end text'ı hesaplamak için start text, H, end text, start superscript, plus, end superscript'nın mol sayısını kullanın

1. Adım: start text, H, end text, start superscript, plus, end superscript'nın mol sayısını hesaplayın

Çözeltideki start text, H, end text, start superscript, plus, end superscript'nın mol sayısını hesaplamak için, orijinal çözeltinin start text, p, H, end text'ını ve hacmini kullanabiliriz.
H+’nın mol sayısı=[H+]başlangıç×hacim=10pHM×hacim=104,0M×0,100 L=1,0×105mol H+\begin{aligned}\text{H}^+&\text{'nın mol sayısı}=[\text H^+]_{başlangıç} \times \text{hacim}\\ \\ &=10^{-\text{pH}}\,\text M \times \text {hacim}\\ \\ &=10^{-4,0}\,\text M \times {0,100\text{ L}}\\ \\ &=1,0 \times 10^{-5}\,\text {mol H}^+\end{aligned}

2. Adım: Seyreltmeden sonraki start text, H, end text, start superscript, plus, end superscript molaritesini hesaplayın

Seyreltilmiş çözeltinin molaritesi, orijinal çözeltideki start text, H, end text, start superscript, plus, end superscript mol ve seyreltmeden sonraki toplam hacim kullanılarak hesaplanabilir.
[H+]son=(H+)’nın mol sayısıL ço¨zelti=1,0×105mol H+1,0L=1,0×105M\begin{aligned}[\text{H}^+]_{son}&=\dfrac{\text{(H}^+)\text {'nın mol sayısı}}{\text{L çözelti}}\\ \\ &=\dfrac{1,0 \times 10^{-5}\,\text {mol H}^+}{1,0\,\text{L}}\\ \\ &=1,0 \times 10^{-5}\,\text M\end{aligned}

3. Adım: open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket'dan start text, p, H, end text'ı hesaplayın

Son olarak, start text, p, H, end text'ı hesaplamak için Denklem 1a'yı kullanabiliriz:
pH=log[H+]=log(1,0×105)=5,0\begin{aligned}\text{pH}&=-\log[\text{H}^+]\\ \\ &=-\text{log}(1,0 \times 10^{-5})\\ \\ &=5,0\end{aligned}
2. Yöntem bize 1. Yöntem ile aynı sonucu veriyor, yaşasın!
Genel olarak, 2. Yöntem birkaç adım fazla sürer, ancak start text, p, H, end text'taki değişimleri bulmak için her zaman kullanılabilir. 1. Yöntem, derişimindeki değişimler, 10'un katları olarak oluştuğunda kullanılacak kısa bir yoldur. 1. Yöntem ayrıca start text, p, H, end text değişimlerini kestirmenin hızlı bir yolu olarak da kullanılabilir.

start text, p, H, end text ve asit kuvveti arasındaki ilişki

start text, p, H, end text denklemine göre, start text, p, H, end text'ın open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket ile ilişkili olduğunu biliyoruz. Bununla birlikte, start text, p, H, end text'ın daima asit kuvvetiyle doğrudan bağlantılı olmadığını aklımızdan çıkarmamalıyız.
Bir asidin kuvveti, asidin bir çözeltide çözünen miktara bağlıdır: asit ne kadar kuvvetliyse, belirli bir asit derişimindeki open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket o kadar yüksektir. Örneğin, kuvvetli bir asit olan start text, H, C, l, end text'in 1, comma, 0, start text, M, end text'lık bir çözeltisi, zayıf bir asit olan start text, H, F, end text'nin 1, comma, 0, start text, M, end text'lık bir çözeltisinden daha yüksek start text, H, end text, start superscript, plus, end superscript derişime sahip olacaktır. Dolayısıyla, aynı derişime sahip iki monoprotik asit çözeltisi için, start text, p, H, end text, asidin kuvvetiyle orantılı olacaktır.
Bununla birlikte, daha genel olarak, hem asit kuvveti hem de derişimin open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket'yı belirlediğini söylemek mümkündür. Bu nedenle, kuvvetli bir asit çözeltisinin start text, p, H, end text'ının her zaman zayıf bir asit çözeltisinin start text, p, H, end text'ından daha düşük olacağını varsayamayız. Asidin derişimi de önemlidir!

Özet

Dört şeritli ıslak pH kağıdını tutan el (soldan sağa renkler: turuncu, yeşil-kahverengi, sarı ve kırmızı-turuncu). Kağıt, pH değerleri ve renklerdem oluşan bir referans tablosuyla karşılaştırma yapmak için kullanılmaktadır. Islak kağıt, referans tablosunda pH 7 ile eşleşmektedir.
Sulu çözeltilerin pH'ını ölçmek için turnusol kağıdı kullanılabilir. Bu resimde turnusaol kağıdının rengi, 7 pH değeriyle eşleşmektedir. Fotoğraf, Wikimedia Commons, CC BY-SA 2.5
  • Aşağıdaki denklemleri kullanarak open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket ve start text, p, H, end text arasında geçiş yapabiliriz:
pH=log[H+][H+]=10pH\begin{aligned}\text{pH}&=-\log[\text{H}^+]\\ \\ [\text H^+]&=10^{-\text{pH}}\end{aligned}
  • Aşağıdaki denklemleri kullanarak open bracket, start text, O, H, end text, start superscript, minus, end superscript, close bracket ve start text, p, O, H, end text arasında geçiş yapabiliriz:
pOH=log[OH][OH]=10pOH\begin{aligned}\text{pOH}&=-\log[\text{OH}^-]\\ \\ [\text {OH}^-]&=10^{-\text{pOH}}\end{aligned}
  • open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket derişiminde 10 faktörlük her artış için, start text, p, H, end text 1 birim azalacaktır, aynı durum, bunun tam tersi için de geçerlidir.
  • 25, degrees, start text, C, end text'deki herhangi bir sulu çözelti için:
start text, p, H, end text, plus, start text, p, O, H, end text, equals, 14.
  • open bracket, start text, H, end text, start superscript, plus, end superscript, close bracket ve start text, p, H, end text'ı, asidin hem kuvveti hem derişimi belirler.

1. Problem: 25, degrees, start text, C, end text'deki kuvvetli bir bazik çözeltinin start text, p, H, end text'ını hesaplayalım

start text, C, a, left parenthesis, O, H, right parenthesis, end text, start subscript, 2, end subscript derişimi 0, comma, 025, start text, space, M, end text olan 200, start text, space, m, L, end text'lik bir çözelti hazırlıyoruz. Bu çözelti, daha sonra su eklenerek hacmi 1, comma, 00, start text, space, L, end text olacak şekilde seyreltiliyor.
Seyreltmeden sonra çözeltinin start text, p, H, end text'ı nedir?
1 cevap seçin:
1 cevap seçin: